About (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride
(2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride (PubChem CID 86683343) has the molecular formula C5H12ClNO2
and a molecular weight of 153.61 g/mol. Its IUPAC name is (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride |
| PubChem CID | 86683343 |
| Molecular Formula | C5H12ClNO2 |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.OC[C@@H]1NCC[C@@H]1O |
| InChI | InChI=1S/C5H11NO2.ClH/c7-3-4-5(8)1-2-6-4;/h4-8H,1-3H2;1H/t4-,5-;/m0./s1 |
| InChIKey | QOJCEWYVJOLFHN-FHAQVOQBSA-N |
| XLogP | -0.88 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride?
The IUPAC name of (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride (CID 86683343) is (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride is Cl.OC[C@@H]1NCC[C@@H]1O.
What is the InChIKey of (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride?
The InChIKey is QOJCEWYVJOLFHN-FHAQVOQBSA-N. The full InChI is InChI=1S/C5H11NO2.ClH/c7-3-4-5(8)1-2-6-4;/h4-8H,1-3H2;1H/t4-,5-;/m0./s1.
What are the key properties of (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride?
(2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride has a molecular weight of 153.61 g/mol, XLogP of -0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(hydroxymethyl)pyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 86683343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).