C9H15F5O2S — CID 86683468
4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-ol (PubChem CID 86683468) has the molecular formula C9H15F5O2S and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-ol.
| Compound Name | 4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-ol |
|---|---|
| PubChem CID | 86683468 |
| Molecular Formula | C9H15F5O2S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-ol |
| SMILES | O=S(CCCCO)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F5O2S/c10-8(11,9(12,13)14)4-3-7-17(16)6-2-1-5-15/h15H,1-7H2 |
| InChIKey | NIGZGKFPIICRJX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|