C8H9F3N4O2 — CID 86683996
2-nitro-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 86683996) has the molecular formula C8H9F3N4O2 and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-nitro-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 2-nitro-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 86683996 |
| Molecular Formula | C8H9F3N4O2 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-nitro-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | O=[N+]([O-])c1cc2n(n1)CCN(CC(F)(F)F)C2 |
| InChI | InChI=1S/C8H9F3N4O2/c9-8(10,11)5-13-1-2-14-6(4-13)3-7(12-14)15(16)17/h3H,1-2,4-5H2 |
| InChIKey | QOIAUTUZDKDDRT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|