C8H10F2N4O2 — CID 86684002
5-(2,2-difluoroethyl)-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 86684002) has the molecular formula C8H10F2N4O2 and a molecular weight of 232.19 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 5-(2,2-difluoroethyl)-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 86684002 |
| Molecular Formula | C8H10F2N4O2 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(2,2-difluoroethyl)-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | O=[N+]([O-])c1cc2n(n1)CCN(CC(F)F)C2 |
| InChI | InChI=1S/C8H10F2N4O2/c9-7(10)5-12-1-2-13-6(4-12)3-8(11-13)14(15)16/h3,7H,1-2,4-5H2 |
| InChIKey | UGZHFKPCFHVYER-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|