C20H28BF2N5O3 — CID 86684006
3-[[5-(2,2-difluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 86684006) has the molecular formula C20H28BF2N5O3 and a molecular weight of 435.28 g/mol. Its IUPAC name is 3-[[5-(2,2-difluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-[[5-(2,2-difluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 86684006 |
| Molecular Formula | C20H28BF2N5O3 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 3-[[5-(2,2-difluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)cc(Nc2cc3n(n2)CCN(CC(F)F)C3)c1=O |
| InChI | InChI=1S/C20H28BF2N5O3/c1-19(2)20(3,4)31-21(30-19)13-8-15(18(29)26(5)10-13)24-17-9-14-11-27(12-16(22)23)6-7-28(14)25-17/h8-10,16H,6-7,11-12H2,1-5H3,(H,24,25) |
| InChIKey | QSYVQNXZJMKGSQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|