C13H17N3O — CID 86684050
2-(2,5-dimethylpyrrol-1-yl)-4-methyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (PubChem CID 86684050) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-4-methyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-4-methyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 86684050 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-4-methyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| SMILES | Cc1ccc(C)n1-c1cc2n(n1)CCOC2C |
| InChI | InChI=1S/C13H17N3O/c1-9-4-5-10(2)16(9)13-8-12-11(3)17-7-6-15(12)14-13/h4-5,8,11H,6-7H2,1-3H3 |
| InChIKey | AHXUAJWPQUJABV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|