C38H40FN9O4 — CID 86684156
[4-fluoro-2-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate (PubChem CID 86684156) has the molecular formula C38H40FN9O4 and a molecular weight of 705.80 g/mol. Its IUPAC name is [4-fluoro-2-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate.
| Compound Name | [4-fluoro-2-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 86684156 |
| Molecular Formula | C38H40FN9O4 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.32 |
| IUPAC Name | [4-fluoro-2-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2nc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)c3[nH]cnc3n2)cc(F)cc1N1CCn2c(cc3c2CCCC3)C1=O |
| InChI | InChI=1S/C38H40FN9O4/c1-23(49)52-21-30-29(17-25(39)18-32(30)48-15-14-47-31-5-3-2-4-24(31)16-33(47)38(48)50)35-43-36-34(40-22-41-36)37(44-35)42-26-6-8-27(9-7-26)45-10-12-46(13-11-45)28-19-51-20-28/h6-9,16-18,22,28H,2-5,10-15,19-21H2,1H3,(H2,40,41,42,43,44) |
| InChIKey | XLWAAYNBAVUVEP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|