C26H26ClN3O5S2 — CID 86684770
3-[(2R)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid (PubChem CID 86684770) has the molecular formula C26H26ClN3O5S2 and a molecular weight of 560.10 g/mol. Its IUPAC name is 3-[(2R)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[(2R)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 86684770 |
| Molecular Formula | C26H26ClN3O5S2 |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 3-[(2R)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1N1C(=O)CN(S(=O)(=O)c2ccc(Cl)nc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C26H26ClN3O5S2/c27-23-12-11-19(14-28-23)37(34,35)29-15-21(17-7-3-1-4-8-17)30(24(31)16-29)20-13-22(36-25(20)26(32)33)18-9-5-2-6-10-18/h2,5-6,9-14,17,21H,1,3-4,7-8,15-16H2,(H,32,33)/t21-/m0/s1 |
| InChIKey | WEZOIGOXMWUNLS-NRFANRHFSA-N |
| XLogP | 5.15 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|