About 12,12-dimethyl-10H-indeno[2,1-b]carbazole
12,12-dimethyl-10H-indeno[2,1-b]carbazole (PubChem CID 86685012) has the molecular formula C21H17N
and a molecular weight of 283.37 g/mol. Its IUPAC name is 12,12-dimethyl-10H-indeno[2,1-b]carbazole.
Molecular Properties
| Compound Name | 12,12-dimethyl-10H-indeno[2,1-b]carbazole |
| PubChem CID | 86685012 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 12,12-dimethyl-10H-indeno[2,1-b]carbazole |
| SMILES | CC1(C)C2=C(C=C3C=CCC=C32)C=C2N=c3ccccc3=C21 |
| InChI | InChI=1S/C21H17N/c1-21(2)19-14(11-13-7-3-4-8-15(13)19)12-18-20(21)16-9-5-6-10-17(16)22-18/h3,5-12H,4H2,1-2H3 |
| InChIKey | YZSBOFITLUNUHC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 12,12-dimethyl-10H-indeno[2,1-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,12-dimethyl-10H-indeno[2,1-b]carbazole?
The IUPAC name of 12,12-dimethyl-10H-indeno[2,1-b]carbazole (CID 86685012) is 12,12-dimethyl-10H-indeno[2,1-b]carbazole.
What is the SMILES notation for 12,12-dimethyl-10H-indeno[2,1-b]carbazole?
The canonical SMILES for 12,12-dimethyl-10H-indeno[2,1-b]carbazole is CC1(C)C2=C(C=C3C=CCC=C32)C=C2N=c3ccccc3=C21.
What is the InChIKey of 12,12-dimethyl-10H-indeno[2,1-b]carbazole?
The InChIKey is YZSBOFITLUNUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N/c1-21(2)19-14(11-13-7-3-4-8-15(13)19)12-18-20(21)16-9-5-6-10-17(16)22-18/h3,5-12H,4H2,1-2H3.
What are the key properties of 12,12-dimethyl-10H-indeno[2,1-b]carbazole?
12,12-dimethyl-10H-indeno[2,1-b]carbazole has a molecular weight of 283.37 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12,12-dimethyl-10H-indeno[2,1-b]carbazole is sourced from PubChem (CID 86685012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).