C36H29N — CID 86685020
10-(9,9-dimethylfluoren-2-yl)-12,12-dimethyl-10H-indeno[2,1-b]carbazole (PubChem CID 86685020) has the molecular formula C36H29N and a molecular weight of 475.64 g/mol. Its IUPAC name is 10-(9,9-dimethylfluoren-2-yl)-12,12-dimethyl-10H-indeno[2,1-b]carbazole.
| Compound Name | 10-(9,9-dimethylfluoren-2-yl)-12,12-dimethyl-10H-indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 86685020 |
| Molecular Formula | C36H29N |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 10-(9,9-dimethylfluoren-2-yl)-12,12-dimethyl-10H-indeno[2,1-b]carbazole |
| SMILES | CC1(C)C2=C(C=C3C=CC(c4ccc5c(c4)C(C)(C)c4ccccc4-5)C=C32)C=C2N=c3ccccc3=C21 |
| InChI | InChI=1S/C36H29N/c1-35(2)29-11-7-5-9-25(29)26-16-15-22(19-30(26)35)21-13-14-23-17-24-20-32-34(27-10-6-8-12-31(27)37-32)36(3,4)33(24)28(23)18-21/h5-21H,1-4H3 |
| InChIKey | IXYUVBZELKFINF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |