C25H25BCl2F3NO5 — CID 86685044
[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (PubChem CID 86685044) has the molecular formula C25H25BCl2F3NO5 and a molecular weight of 558.19 g/mol. Its IUPAC name is [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate.
| Compound Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 86685044 |
| Molecular Formula | C25H25BCl2F3NO5 |
| Molecular Weight | 558.19 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H25BCl2F3NO5/c1-14(33)34-13-16-8-15(6-7-20(16)26-35-22(2,3)23(4,5)36-26)21-12-24(37-32-21,25(29,30)31)17-9-18(27)11-19(28)10-17/h6-11H,12-13H2,1-5H3 |
| InChIKey | NBFLVXJGBMLMBU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.19 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|