C10H5Cl2F5 — CID 86685056
1,3-dichloro-5-(3,3,4,4,4-pentafluorobut-1-en-2-yl)benzene (PubChem CID 86685056) has the molecular formula C10H5Cl2F5 and a molecular weight of 291.05 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3,4,4,4-pentafluorobut-1-en-2-yl)benzene.
| Compound Name | 1,3-dichloro-5-(3,3,4,4,4-pentafluorobut-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 86685056 |
| Molecular Formula | C10H5Cl2F5 |
| Molecular Weight | 291.05 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 1,3-dichloro-5-(3,3,4,4,4-pentafluorobut-1-en-2-yl)benzene |
| SMILES | C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5Cl2F5/c1-5(9(13,14)10(15,16)17)6-2-7(11)4-8(12)3-6/h2-4H,1H2 |
| InChIKey | QAMOBBJCMNXYEJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.05 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|