C10H10BClFNO3 — CID 86685099
6-fluoro-N,1-dihydroxy-3,3-dimethyl-2,1-benzoxaborole-5-carboximidoyl chloride (PubChem CID 86685099) has the molecular formula C10H10BClFNO3 and a molecular weight of 257.46 g/mol. Its IUPAC name is 6-fluoro-N,1-dihydroxy-3,3-dimethyl-2,1-benzoxaborole-5-carboximidoyl chloride.
| Compound Name | 6-fluoro-N,1-dihydroxy-3,3-dimethyl-2,1-benzoxaborole-5-carboximidoyl chloride |
|---|---|
| PubChem CID | 86685099 |
| Molecular Formula | C10H10BClFNO3 |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 6-fluoro-N,1-dihydroxy-3,3-dimethyl-2,1-benzoxaborole-5-carboximidoyl chloride |
| SMILES | CC1(C)OB(O)c2cc(F)c(C(Cl)=NO)cc21 |
| InChI | InChI=1S/C10H10BClFNO3/c1-10(2)6-3-5(9(12)14-16)8(13)4-7(6)11(15)17-10/h3-4,15-16H,1-2H3 |
| InChIKey | HBSDHSDBGJSMMY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|