About [(1R,2S)-2-methylcyclohexyl] methanesulfonate
[(1R,2S)-2-methylcyclohexyl] methanesulfonate (PubChem CID 86685285) has the molecular formula C8H16O3S
and a molecular weight of 192.28 g/mol. Its IUPAC name is [(1R,2S)-2-methylcyclohexyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1R,2S)-2-methylcyclohexyl] methanesulfonate |
| PubChem CID | 86685285 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [(1R,2S)-2-methylcyclohexyl] methanesulfonate |
| SMILES | C[C@H]1CCCC[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C8H16O3S/c1-7-5-3-4-6-8(7)11-12(2,9)10/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | WQACUBIAIFEJIX-JGVFFNPUSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-methylcyclohexyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-methylcyclohexyl] methanesulfonate?
The IUPAC name of [(1R,2S)-2-methylcyclohexyl] methanesulfonate (CID 86685285) is [(1R,2S)-2-methylcyclohexyl] methanesulfonate.
What is the SMILES notation for [(1R,2S)-2-methylcyclohexyl] methanesulfonate?
The canonical SMILES for [(1R,2S)-2-methylcyclohexyl] methanesulfonate is C[C@H]1CCCC[C@H]1OS(C)(=O)=O.
What is the InChIKey of [(1R,2S)-2-methylcyclohexyl] methanesulfonate?
The InChIKey is WQACUBIAIFEJIX-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H16O3S/c1-7-5-3-4-6-8(7)11-12(2,9)10/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1.
What are the key properties of [(1R,2S)-2-methylcyclohexyl] methanesulfonate?
[(1R,2S)-2-methylcyclohexyl] methanesulfonate has a molecular weight of 192.28 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-methylcyclohexyl] methanesulfonate is sourced from PubChem (CID 86685285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).