About N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride
N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride (PubChem CID 86685442) has the molecular formula C13H26ClN3
and a molecular weight of 259.83 g/mol. Its IUPAC name is N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride |
| PubChem CID | 86685442 |
| Molecular Formula | C13H26ClN3 |
| Molecular Weight | 259.83 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride |
| SMILES | CCN(CC)CC.Cc1ccc(NN)cc1.Cl |
| InChI | InChI=1S/C7H10N2.C6H15N.ClH/c1-6-2-4-7(9-8)5-3-6;1-4-7(5-2)6-3;/h2-5,9H,8H2,1H3;4-6H2,1-3H3;1H |
| InChIKey | GCIUBZXKHKKISP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride?
The IUPAC name of N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride (CID 86685442) is N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride.
What is the SMILES notation for N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride?
The canonical SMILES for N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride is CCN(CC)CC.Cc1ccc(NN)cc1.Cl.
What is the InChIKey of N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride?
The InChIKey is GCIUBZXKHKKISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H15N.ClH/c1-6-2-4-7(9-8)5-3-6;1-4-7(5-2)6-3;/h2-5,9H,8H2,1H3;4-6H2,1-3H3;1H.
What are the key properties of N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride?
N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride has a molecular weight of 259.83 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;(4-methylphenyl)hydrazine;hydrochloride is sourced from PubChem (CID 86685442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).