C25H27F8NO3S — CID 86685885
2-methyl-N-[1,1,1,3,3-pentafluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide (PubChem CID 86685885) has the molecular formula C25H27F8NO3S and a molecular weight of 573.55 g/mol. Its IUPAC name is 2-methyl-N-[1,1,1,3,3-pentafluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[1,1,1,3,3-pentafluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 86685885 |
| Molecular Formula | C25H27F8NO3S |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 2-methyl-N-[1,1,1,3,3-pentafluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide |
| SMILES | Cc1ccc(C(=O)C(F)(F)C(NS(=O)C(C)(C)C)(c2ccc(OCCCC(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27F8NO3S/c1-16-6-8-17(9-7-16)20(35)24(29,30)23(25(31,32)33,34-38(36)21(2,3)4)18-10-12-19(13-11-18)37-15-5-14-22(26,27)28/h6-13,34H,5,14-15H2,1-4H3 |
| InChIKey | CQSDHPJTNKDASY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|