C15H25BrN2OSi — CID 86686011
[(3S)-1-(5-bromo-3-pyridinyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 86686011) has the molecular formula C15H25BrN2OSi and a molecular weight of 357.37 g/mol. Its IUPAC name is [(3S)-1-(5-bromo-3-pyridinyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S)-1-(5-bromo-3-pyridinyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 86686011 |
| Molecular Formula | C15H25BrN2OSi |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [(3S)-1-(5-bromo-3-pyridinyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN(c2cncc(Br)c2)C1 |
| InChI | InChI=1S/C15H25BrN2OSi/c1-15(2,3)20(4,5)19-14-6-7-18(11-14)13-8-12(16)9-17-10-13/h8-10,14H,6-7,11H2,1-5H3/t14-/m0/s1 |
| InChIKey | AOWYYBFCPZTPBD-AWEZNQCLSA-N |
| XLogP | 4.44 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|