About (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid
(2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid (PubChem CID 86686389) has the molecular formula C8H12BNO3
and a molecular weight of 181.00 g/mol. Its IUPAC name is (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid.
Molecular Properties
| Compound Name | (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid |
| PubChem CID | 86686389 |
| Molecular Formula | C8H12BNO3 |
| Molecular Weight | 181.00 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid |
| SMILES | COc1nc(C)cc(C)c1B(O)O |
| InChI | InChI=1S/C8H12BNO3/c1-5-4-6(2)10-8(13-3)7(5)9(11)12/h4,11-12H,1-3H3 |
| InChIKey | SDLXRGHGPFPFHW-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.00 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid?
The IUPAC name of (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid (CID 86686389) is (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid.
What is the SMILES notation for (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid?
The canonical SMILES for (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid is COc1nc(C)cc(C)c1B(O)O.
What is the InChIKey of (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid?
The InChIKey is SDLXRGHGPFPFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BNO3/c1-5-4-6(2)10-8(13-3)7(5)9(11)12/h4,11-12H,1-3H3.
What are the key properties of (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid?
(2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid has a molecular weight of 181.00 g/mol, XLogP of -0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4,6-dimethyl-3-pyridinyl)boronic acid is sourced from PubChem (CID 86686389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).