C17H14F6N2O5S — CID 86686467
N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-nitrobenzenesulfonamide (PubChem CID 86686467) has the molecular formula C17H14F6N2O5S and a molecular weight of 472.36 g/mol. Its IUPAC name is N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 86686467 |
| Molecular Formula | C17H14F6N2O5S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-nitrobenzenesulfonamide |
| SMILES | CCN(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14F6N2O5S/c1-2-24(31(29,30)14-9-7-13(8-10-14)25(27)28)12-5-3-11(4-6-12)15(26,16(18,19)20)17(21,22)23/h3-10,26H,2H2,1H3 |
| InChIKey | HDSUBBVYNOVHHL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|