About 3-benzylsulfanyl-8-chloro-1,7-naphthyridine
3-benzylsulfanyl-8-chloro-1,7-naphthyridine (PubChem CID 86687547) has the molecular formula C15H11ClN2S
and a molecular weight of 286.79 g/mol. Its IUPAC name is 3-benzylsulfanyl-8-chloro-1,7-naphthyridine.
Molecular Properties
| Compound Name | 3-benzylsulfanyl-8-chloro-1,7-naphthyridine |
| PubChem CID | 86687547 |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-benzylsulfanyl-8-chloro-1,7-naphthyridine |
| SMILES | Clc1nccc2cc(SCc3ccccc3)cnc12 |
| InChI | InChI=1S/C15H11ClN2S/c16-15-14-12(6-7-17-15)8-13(9-18-14)19-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | IXZFTICMQRBMPL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylsulfanyl-8-chloro-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfanyl-8-chloro-1,7-naphthyridine?
The IUPAC name of 3-benzylsulfanyl-8-chloro-1,7-naphthyridine (CID 86687547) is 3-benzylsulfanyl-8-chloro-1,7-naphthyridine.
What is the SMILES notation for 3-benzylsulfanyl-8-chloro-1,7-naphthyridine?
The canonical SMILES for 3-benzylsulfanyl-8-chloro-1,7-naphthyridine is Clc1nccc2cc(SCc3ccccc3)cnc12.
What is the InChIKey of 3-benzylsulfanyl-8-chloro-1,7-naphthyridine?
The InChIKey is IXZFTICMQRBMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2S/c16-15-14-12(6-7-17-15)8-13(9-18-14)19-10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 3-benzylsulfanyl-8-chloro-1,7-naphthyridine?
3-benzylsulfanyl-8-chloro-1,7-naphthyridine has a molecular weight of 286.79 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfanyl-8-chloro-1,7-naphthyridine is sourced from PubChem (CID 86687547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).