C23H23N5O4S — CID 86687686
1-[2-methoxy-6-(2-methylpropoxy)-3-pyridinyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide (PubChem CID 86687686) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-[2-methoxy-6-(2-methylpropoxy)-3-pyridinyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide.
| Compound Name | 1-[2-methoxy-6-(2-methylpropoxy)-3-pyridinyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 86687686 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-[2-methoxy-6-(2-methylpropoxy)-3-pyridinyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide |
| SMILES | COc1nc(OCC(C)C)ccc1-c1nccc2cc(S(=O)(=O)Nc3ccncn3)ccc12 |
| InChI | InChI=1S/C23H23N5O4S/c1-15(2)13-32-21-7-6-19(23(27-21)31-3)22-18-5-4-17(12-16(18)8-11-25-22)33(29,30)28-20-9-10-24-14-26-20/h4-12,14-15H,13H2,1-3H3,(H,24,26,28) |
| InChIKey | VQDDNIYLGOWNDN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |