C17H12ClF3N2O4S — CID 86687744
2-methoxy-4-[2-methoxy-4-(trifluoromethyl)phenyl]quinazoline-7-sulfonyl chloride (PubChem CID 86687744) has the molecular formula C17H12ClF3N2O4S and a molecular weight of 432.81 g/mol. Its IUPAC name is 2-methoxy-4-[2-methoxy-4-(trifluoromethyl)phenyl]quinazoline-7-sulfonyl chloride.
| Compound Name | 2-methoxy-4-[2-methoxy-4-(trifluoromethyl)phenyl]quinazoline-7-sulfonyl chloride |
|---|---|
| PubChem CID | 86687744 |
| Molecular Formula | C17H12ClF3N2O4S |
| Molecular Weight | 432.81 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-methoxy-4-[2-methoxy-4-(trifluoromethyl)phenyl]quinazoline-7-sulfonyl chloride |
| SMILES | COc1nc(-c2ccc(C(F)(F)F)cc2OC)c2ccc(S(=O)(=O)Cl)cc2n1 |
| InChI | InChI=1S/C17H12ClF3N2O4S/c1-26-14-7-9(17(19,20)21)3-5-12(14)15-11-6-4-10(28(18,24)25)8-13(11)22-16(23-15)27-2/h3-8H,1-2H3 |
| InChIKey | JNCYPIGJFQZXJM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |