C22H22N6O2 — CID 86687899
1-[9-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydropyrido[2,3-f][1,4]benzoxazin-1-yl]ethanone (PubChem CID 86687899) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[9-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydropyrido[2,3-f][1,4]benzoxazin-1-yl]ethanone.
| Compound Name | 1-[9-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydropyrido[2,3-f][1,4]benzoxazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86687899 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[9-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydropyrido[2,3-f][1,4]benzoxazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCOc2ccc3ccc(CCc4nc5c(C)ncc(C)n5n4)nc3c21 |
| InChI | InChI=1S/C22H22N6O2/c1-13-12-23-14(2)22-25-19(26-28(13)22)9-7-17-6-4-16-5-8-18-21(20(16)24-17)27(15(3)29)10-11-30-18/h4-6,8,12H,7,9-11H2,1-3H3 |
| InChIKey | JGEGQZCOXQMNTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |