C18H18F2N6O2S — CID 86687906
5-[5-(azidomethyl)-2-methylphenyl]-1-[(2,2-difluorocyclopropyl)methyl]-3-methyl-[1,2,5]thiadiazolo[3,4-b]pyridine 2,2-dioxide (PubChem CID 86687906) has the molecular formula C18H18F2N6O2S and a molecular weight of 420.45 g/mol. Its IUPAC name is 5-[5-(azidomethyl)-2-methylphenyl]-1-[(2,2-difluorocyclopropyl)methyl]-3-methyl-[1,2,5]thiadiazolo[3,4-b]pyridine 2,2-dioxide.
| Compound Name | 5-[5-(azidomethyl)-2-methylphenyl]-1-[(2,2-difluorocyclopropyl)methyl]-3-methyl-[1,2,5]thiadiazolo[3,4-b]pyridine 2,2-dioxide |
|---|---|
| PubChem CID | 86687906 |
| Molecular Formula | C18H18F2N6O2S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 5-[5-(azidomethyl)-2-methylphenyl]-1-[(2,2-difluorocyclopropyl)methyl]-3-methyl-[1,2,5]thiadiazolo[3,4-b]pyridine 2,2-dioxide |
| SMILES | Cc1ccc(CN=[N+]=[N-])cc1-c1ccc2c(n1)N(C)S(=O)(=O)N2CC1CC1(F)F |
| InChI | InChI=1S/C18H18F2N6O2S/c1-11-3-4-12(9-22-24-21)7-14(11)15-5-6-16-17(23-15)25(2)29(27,28)26(16)10-13-8-18(13,19)20/h3-7,13H,8-10H2,1-2H3 |
| InChIKey | UAFXZCCRXFISST-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 102.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|