C19H22BN3O2 — CID 86688175
2-(3-methyl-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 86688175) has the molecular formula C19H22BN3O2 and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-(3-methyl-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-(3-methyl-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 86688175 |
| Molecular Formula | C19H22BN3O2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-(3-methyl-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cnccc1-c1cc2cc(B3OC(C)(C)C(C)(C)O3)cnc2[nH]1 |
| InChI | InChI=1S/C19H22BN3O2/c1-12-10-21-7-6-15(12)16-9-13-8-14(11-22-17(13)23-16)20-24-18(2,3)19(4,5)25-20/h6-11H,1-5H3,(H,22,23) |
| InChIKey | PKYARSFBOIQKTC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|