C19H16O3 — CID 86688375
3-acetyl-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one (PubChem CID 86688375) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-acetyl-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one.
| Compound Name | 3-acetyl-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
|---|---|
| PubChem CID | 86688375 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-acetyl-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
| SMILES | CC(=O)c1ccc2c(c1)COc1cc3c(cc1-2)CCCC3=O |
| InChI | InChI=1S/C19H16O3/c1-11(20)12-5-6-15-14(7-12)10-22-19-9-16-13(8-17(15)19)3-2-4-18(16)21/h5-9H,2-4,10H2,1H3 |
| InChIKey | HEDVCJIUEKLCCV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |