About 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]
8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (PubChem CID 86688723) has the molecular formula C12H13BrO2
and a molecular weight of 269.14 g/mol. Its IUPAC name is 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
Molecular Properties
| Compound Name | 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
| PubChem CID | 86688723 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
| SMILES | Brc1cccc2c1CCC1(C2)OCCO1 |
| InChI | InChI=1S/C12H13BrO2/c13-11-3-1-2-9-8-12(5-4-10(9)11)14-6-7-15-12/h1-3H,4-8H2 |
| InChIKey | YCPQKWACMRWIIU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The IUPAC name of 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (CID 86688723) is 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
What is the SMILES notation for 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The canonical SMILES for 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is Brc1cccc2c1CCC1(C2)OCCO1.
What is the InChIKey of 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The InChIKey is YCPQKWACMRWIIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO2/c13-11-3-1-2-9-8-12(5-4-10(9)11)14-6-7-15-12/h1-3H,4-8H2.
What are the key properties of 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] has a molecular weight of 269.14 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-bromospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is sourced from PubChem (CID 86688723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).