C25H29N7O4S — CID 86689219
5-(3-morpholin-4-ylpropylcarbamoylamino)-3-[4-(phenylcarbamoylamino)phenyl]-1,2-thiazole-4-carboxamide (PubChem CID 86689219) has the molecular formula C25H29N7O4S and a molecular weight of 523.62 g/mol. Its IUPAC name is 5-(3-morpholin-4-ylpropylcarbamoylamino)-3-[4-(phenylcarbamoylamino)phenyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(3-morpholin-4-ylpropylcarbamoylamino)-3-[4-(phenylcarbamoylamino)phenyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86689219 |
| Molecular Formula | C25H29N7O4S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 5-(3-morpholin-4-ylpropylcarbamoylamino)-3-[4-(phenylcarbamoylamino)phenyl]-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(NC(=O)Nc3ccccc3)cc2)nsc1NC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C25H29N7O4S/c26-22(33)20-21(17-7-9-19(10-8-17)29-25(35)28-18-5-2-1-3-6-18)31-37-23(20)30-24(34)27-11-4-12-32-13-15-36-16-14-32/h1-3,5-10H,4,11-16H2,(H2,26,33)(H2,27,30,34)(H2,28,29,35) |
| InChIKey | DVMIIUOULRDNLG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|