C23H24N6O5S — CID 86689228
4-[[4-carbamoyl-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazol-5-yl]carbamoylamino]butanoic acid (PubChem CID 86689228) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is 4-[[4-carbamoyl-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazol-5-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-carbamoyl-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazol-5-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 86689228 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-[[4-carbamoyl-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazol-5-yl]carbamoylamino]butanoic acid |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3nsc(NC(=O)NCCCC(=O)O)c3C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H24N6O5S/c1-13-4-8-15(9-5-13)26-23(34)27-16-10-6-14(7-11-16)19-18(20(24)32)21(35-29-19)28-22(33)25-12-2-3-17(30)31/h4-11H,2-3,12H2,1H3,(H2,24,32)(H,30,31)(H2,25,28,33)(H2,26,27,34) |
| InChIKey | LUIRMPBUMLMGFN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|