C16H24O5 — CID 86690104
2-O'-tert-butyl 2-O-ethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 86690104) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-O'-tert-butyl 2-O-ethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | 2-O'-tert-butyl 2-O-ethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 86690104 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-O'-tert-butyl 2-O-ethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OC(C)(C)C)CC2CC(=O)CC2C1 |
| InChI | InChI=1S/C16H24O5/c1-5-20-13(18)16(14(19)21-15(2,3)4)8-10-6-12(17)7-11(10)9-16/h10-11H,5-9H2,1-4H3 |
| InChIKey | PPEXRIVGYHKJAP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|