About chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate
chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate (PubChem CID 86690206) has the molecular formula C19H21ClN4O2S
and a molecular weight of 404.92 g/mol. Its IUPAC name is chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate.
Molecular Properties
| Compound Name | chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate |
| PubChem CID | 86690206 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate |
| SMILES | Cc1cc2c(s1)N(C(=O)OCCl)c1ccccc1N=C2N1CCN(C)CC1 |
| InChI | InChI=1S/C19H21ClN4O2S/c1-13-11-14-17(23-9-7-22(2)8-10-23)21-15-5-3-4-6-16(15)24(18(14)27-13)19(25)26-12-20/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | QXIOTVBNNDRHJU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate?
The IUPAC name of chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate (CID 86690206) is chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate.
What is the SMILES notation for chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate?
The canonical SMILES for chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate is Cc1cc2c(s1)N(C(=O)OCCl)c1ccccc1N=C2N1CCN(C)CC1.
What is the InChIKey of chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate?
The InChIKey is QXIOTVBNNDRHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN4O2S/c1-13-11-14-17(23-9-7-22(2)8-10-23)21-15-5-3-4-6-16(15)24(18(14)27-13)19(25)26-12-20/h3-6,11H,7-10,12H2,1-2H3.
What are the key properties of chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate?
chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate has a molecular weight of 404.92 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-b][1,5]benzodiazepine-10-carboxylate is sourced from PubChem (CID 86690206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).