C24H25N3 — CID 86690337
6,7-diethyl-2,3-bis(4-methylphenyl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 86690337) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is 6,7-diethyl-2,3-bis(4-methylphenyl)-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 6,7-diethyl-2,3-bis(4-methylphenyl)-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 86690337 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 6,7-diethyl-2,3-bis(4-methylphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | CCc1[nH]c2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)nc2c1CC |
| InChI | InChI=1S/C24H25N3/c1-5-19-20(6-2)25-24-23(19)26-21(17-11-7-15(3)8-12-17)22(27-24)18-13-9-16(4)10-14-18/h7-14H,5-6H2,1-4H3,(H,25,27) |
| InChIKey | WWNFVIXMGXAOIV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |