C35H33F4NO3 — CID 86690530
11-(2-ethylhexyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde (PubChem CID 86690530) has the molecular formula C35H33F4NO3 and a molecular weight of 591.65 g/mol. Its IUPAC name is 11-(2-ethylhexyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde.
| Compound Name | 11-(2-ethylhexyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde |
|---|---|
| PubChem CID | 86690530 |
| Molecular Formula | C35H33F4NO3 |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 11-(2-ethylhexyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(C=O)c3ccccc3c21 |
| InChI | InChI=1S/C35H33F4NO3/c1-3-5-10-22(4-2)19-40-30-16-15-23(33(42)27-13-8-9-14-31(27)43-21-35(38,39)34(36)37)17-28(30)29-18-24(20-41)25-11-6-7-12-26(25)32(29)40/h6-9,11-18,20,22,34H,3-5,10,19,21H2,1-2H3 |
| InChIKey | YABKTUKMFIWEDF-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|