C44H46F4N2O2 — CID 86690533
N-[[11-(2-ethylhexyl)-5-[[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methylidene]hydroxylamine (PubChem CID 86690533) has the molecular formula C44H46F4N2O2 and a molecular weight of 710.86 g/mol. Its IUPAC name is N-[[11-(2-ethylhexyl)-5-[[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methylidene]hydroxylamine.
| Compound Name | N-[[11-(2-ethylhexyl)-5-[[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 86690533 |
| Molecular Formula | C44H46F4N2O2 |
| Molecular Weight | 710.86 g/mol |
| Exact Mass | 710.35 |
| IUPAC Name | N-[[11-(2-ethylhexyl)-5-[[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methylidene]hydroxylamine |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NO)c3c(C)cc(C)cc3C)cc2c2cc(Cc3ccc(OCC(F)(F)C(F)F)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C44H46F4N2O2/c1-6-8-11-30(7-2)25-50-39-19-16-32(41(49-51)40-28(4)20-27(3)21-29(40)5)23-37(39)38-24-33(35-12-9-10-13-36(35)42(38)50)22-31-14-17-34(18-15-31)52-26-44(47,48)43(45)46/h9-10,12-21,23-24,30,43,51H,6-8,11,22,25-26H2,1-5H3 |
| InChIKey | DYROSUDVYHINEG-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.86 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|