About 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone
1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone (PubChem CID 86690658) has the molecular formula C22H27N3O4S
and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone |
| PubChem CID | 86690658 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)OCCN(S(=O)(=O)Cc2ccccc2)C3)CC1 |
| InChI | InChI=1S/C22H27N3O4S/c1-18(26)23-9-11-24(12-10-23)21-8-7-20-16-25(13-14-29-22(20)15-21)30(27,28)17-19-5-3-2-4-6-19/h2-8,15H,9-14,16-17H2,1H3 |
| InChIKey | YDHSYELCBSWTAF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone (CID 86690658) is 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone is CC(=O)N1CCN(c2ccc3c(c2)OCCN(S(=O)(=O)Cc2ccccc2)C3)CC1.
What is the InChIKey of 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone?
The InChIKey is YDHSYELCBSWTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4S/c1-18(26)23-9-11-24(12-10-23)21-8-7-20-16-25(13-14-29-22(20)15-21)30(27,28)17-19-5-3-2-4-6-19/h2-8,15H,9-14,16-17H2,1H3.
What are the key properties of 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone?
1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone has a molecular weight of 429.54 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-benzylsulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-8-yl)piperazin-1-yl]ethanone is sourced from PubChem (CID 86690658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).