C18H26F3N3OSi — CID 86690728
tert-butyl-dimethyl-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane (PubChem CID 86690728) has the molecular formula C18H26F3N3OSi and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane |
|---|---|
| PubChem CID | 86690728 |
| Molecular Formula | C18H26F3N3OSi |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl-dimethyl-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccnc1-c1ccnn1CCC(F)(F)F |
| InChI | InChI=1S/C18H26F3N3OSi/c1-17(2,3)26(4,5)25-13-14-7-6-10-22-16(14)15-8-11-23-24(15)12-9-18(19,20)21/h6-8,10-11H,9,12-13H2,1-5H3 |
| InChIKey | IVQOVGKPEVFHHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|