C27H27N3O4S — CID 86690870
N-[4-[4-[4-(3-methoxypropoxy)phenoxy]-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 86690870) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[4-[4-[4-(3-methoxypropoxy)phenoxy]-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-[4-(3-methoxypropoxy)phenoxy]-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 86690870 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[4-[4-[4-(3-methoxypropoxy)phenoxy]-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | COCCCOc1ccc(Oc2cc(C)c(-c3csc(NC(=O)c4ccncc4)n3)c(C)c2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-18-15-23(34-22-7-5-21(6-8-22)33-14-4-13-32-3)16-19(2)25(18)24-17-35-27(29-24)30-26(31)20-9-11-28-12-10-20/h5-12,15-17H,4,13-14H2,1-3H3,(H,29,30,31) |
| InChIKey | GSTRHXFIWDNYDJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|