C29H32F2N8O4 — CID 86690892
6-[difluoro-(3-nitrophenyl)methyl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-9-(oxan-2-yl)purin-2-amine (PubChem CID 86690892) has the molecular formula C29H32F2N8O4 and a molecular weight of 594.62 g/mol. Its IUPAC name is 6-[difluoro-(3-nitrophenyl)methyl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-9-(oxan-2-yl)purin-2-amine.
| Compound Name | 6-[difluoro-(3-nitrophenyl)methyl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-9-(oxan-2-yl)purin-2-amine |
|---|---|
| PubChem CID | 86690892 |
| Molecular Formula | C29H32F2N8O4 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | 6-[difluoro-(3-nitrophenyl)methyl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-9-(oxan-2-yl)purin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc(C(F)(F)c2cccc([N+](=O)[O-])c2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C29H32F2N8O4/c1-36-11-13-37(14-12-36)20-9-10-22(23(17-20)42-2)33-28-34-26(29(30,31)19-6-5-7-21(16-19)39(40)41)25-27(35-28)38(18-32-25)24-8-3-4-15-43-24/h5-7,9-10,16-18,24H,3-4,8,11-15H2,1-2H3,(H,33,34,35) |
| InChIKey | AUWKFSHWTXNZJG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|