C30H39F2N7OSi — CID 86690897
4-[(3-aminophenyl)-difluoromethyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 86690897) has the molecular formula C30H39F2N7OSi and a molecular weight of 579.77 g/mol. Its IUPAC name is 4-[(3-aminophenyl)-difluoromethyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[(3-aminophenyl)-difluoromethyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86690897 |
| Molecular Formula | C30H39F2N7OSi |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 4-[(3-aminophenyl)-difluoromethyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(C(F)(F)c4cccc(N)c4)c4ccn(COCC[Si](C)(C)C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C30H39F2N7OSi/c1-37-14-16-38(17-15-37)25-10-8-24(9-11-25)34-29-35-27(30(31,32)22-6-5-7-23(33)20-22)26-12-13-39(28(26)36-29)21-40-18-19-41(2,3)4/h5-13,20H,14-19,21,33H2,1-4H3,(H,34,35,36) |
| InChIKey | PPUSGDLIHQENJN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|