C30H37F2N7O3Si — CID 86690898
4-[difluoro-(3-nitrophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 86690898) has the molecular formula C30H37F2N7O3Si and a molecular weight of 609.75 g/mol. Its IUPAC name is 4-[difluoro-(3-nitrophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[difluoro-(3-nitrophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86690898 |
| Molecular Formula | C30H37F2N7O3Si |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | 4-[difluoro-(3-nitrophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(C(F)(F)c4cccc([N+](=O)[O-])c4)c4ccn(COCC[Si](C)(C)C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C30H37F2N7O3Si/c1-36-14-16-37(17-15-36)24-10-8-23(9-11-24)33-29-34-27(30(31,32)22-6-5-7-25(20-22)39(40)41)26-12-13-38(28(26)35-29)21-42-18-19-43(2,3)4/h5-13,20H,14-19,21H2,1-4H3,(H,33,34,35) |
| InChIKey | CYYLLVFESLEUGR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|