C30H38F3N7OSi — CID 86690899
4-[(3-aminophenyl)-difluoromethyl]-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 86690899) has the molecular formula C30H38F3N7OSi and a molecular weight of 597.76 g/mol. Its IUPAC name is 4-[(3-aminophenyl)-difluoromethyl]-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[(3-aminophenyl)-difluoromethyl]-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86690899 |
| Molecular Formula | C30H38F3N7OSi |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 4-[(3-aminophenyl)-difluoromethyl]-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(C(F)(F)c4cccc(N)c4)c4ccn(COCC[Si](C)(C)C)c4n3)cc2F)CC1 |
| InChI | InChI=1S/C30H38F3N7OSi/c1-38-12-14-39(15-13-38)26-9-8-23(19-25(26)31)35-29-36-27(30(32,33)21-6-5-7-22(34)18-21)24-10-11-40(28(24)37-29)20-41-16-17-42(2,3)4/h5-11,18-19H,12-17,20,34H2,1-4H3,(H,35,36,37) |
| InChIKey | LGTNSPARIGEBFN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|