C29H36F2N8O3Si — CID 86690900
4-[difluoro-(3-nitrophenyl)methyl]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 86690900) has the molecular formula C29H36F2N8O3Si and a molecular weight of 610.74 g/mol. Its IUPAC name is 4-[difluoro-(3-nitrophenyl)methyl]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[difluoro-(3-nitrophenyl)methyl]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86690900 |
| Molecular Formula | C29H36F2N8O3Si |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 4-[difluoro-(3-nitrophenyl)methyl]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(C(F)(F)c4cccc([N+](=O)[O-])c4)c4ccn(COCC[Si](C)(C)C)c4n3)cn2)CC1 |
| InChI | InChI=1S/C29H36F2N8O3Si/c1-36-12-14-37(15-13-36)25-9-8-22(19-32-25)33-28-34-26(29(30,31)21-6-5-7-23(18-21)39(40)41)24-10-11-38(27(24)35-28)20-42-16-17-43(2,3)4/h5-11,18-19H,12-17,20H2,1-4H3,(H,33,34,35) |
| InChIKey | VPDSAHORATTXIO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|