C21H14ClF6N5O2S — CID 86690916
5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]-1,2,4-triazol-3-one (PubChem CID 86690916) has the molecular formula C21H14ClF6N5O2S and a molecular weight of 549.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 86690916 |
| Molecular Formula | C21H14ClF6N5O2S |
| Molecular Weight | 549.88 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nnc(-c3ccccc3C(F)(F)F)s2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C21H14ClF6N5O2S/c22-12-7-5-11(6-8-12)17-31-33(19(35)32(17)9-15(34)21(26,27)28)10-16-29-30-18(36-16)13-3-1-2-4-14(13)20(23,24)25/h1-8,15,34H,9-10H2/t15-/m0/s1 |
| InChIKey | GRJNKBDCMVJZIA-HNNXBMFYSA-N |
| XLogP | 4.87 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |