C22H18Cl2F3N7O3 — CID 86690917
2-[5-(2-chlorophenyl)-3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide (PubChem CID 86690917) has the molecular formula C22H18Cl2F3N7O3 and a molecular weight of 556.33 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)-3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide.
| Compound Name | 2-[5-(2-chlorophenyl)-3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 86690917 |
| Molecular Formula | C22H18Cl2F3N7O3 |
| Molecular Weight | 556.33 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | 2-[5-(2-chlorophenyl)-3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C22H18Cl2F3N7O3/c23-13-7-5-12(6-8-13)19-31-34(21(37)32(19)9-16(35)22(25,26)27)11-18-29-20(33(30-18)10-17(28)36)14-3-1-2-4-15(14)24/h1-8,16,35H,9-11H2,(H2,28,36)/t16-/m0/s1 |
| InChIKey | CYQJEYVBTAZXQH-INIZCTEOSA-N |
| XLogP | 2.73 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |