C13H17BrN2O2 — CID 86691195
tert-butyl N-[(1R,2S)-2-(6-bromo-3-pyridinyl)cyclopropyl]carbamate (PubChem CID 86691195) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.20 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-(6-bromo-3-pyridinyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-(6-bromo-3-pyridinyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 86691195 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-(6-bromo-3-pyridinyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1ccc(Br)nc1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-13(2,3)18-12(17)16-10-6-9(10)8-4-5-11(14)15-7-8/h4-5,7,9-10H,6H2,1-3H3,(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | JHMPRBHRNWAIBF-VHSXEESVSA-N |
| XLogP | 3.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|