C25H31N5O2S — CID 86691424
tert-butyl N-[2-[[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylquinazolin-4-yl]amino]ethyl]carbamate (PubChem CID 86691424) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylquinazolin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylquinazolin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 86691424 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | tert-butyl N-[2-[[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylquinazolin-4-yl]amino]ethyl]carbamate |
| SMILES | Cc1ccc2nc(N3CCSc4ccccc4C3)nc(NCCNC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C25H31N5O2S/c1-17-9-10-20-19(15-17)22(26-11-12-27-24(31)32-25(2,3)4)29-23(28-20)30-13-14-33-21-8-6-5-7-18(21)16-30/h5-10,15H,11-14,16H2,1-4H3,(H,27,31)(H,26,28,29) |
| InChIKey | VGKPQXGBDUYDBS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|