About 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde
2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde (PubChem CID 86691435) has the molecular formula C25H21N3O2S
and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde.
Molecular Properties
| Compound Name | 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde |
| PubChem CID | 86691435 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(N3CCSc4ccccc4C3)nc(OCc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H21N3O2S/c29-16-19-10-11-22-21(14-19)24(30-17-18-6-2-1-3-7-18)27-25(26-22)28-12-13-31-23-9-5-4-8-20(23)15-28/h1-11,14,16H,12-13,15,17H2 |
| InChIKey | JBORFRFCQBWOEG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde?
The IUPAC name of 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde (CID 86691435) is 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde.
What is the SMILES notation for 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde?
The canonical SMILES for 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde is O=Cc1ccc2nc(N3CCSc4ccccc4C3)nc(OCc3ccccc3)c2c1.
What is the InChIKey of 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde?
The InChIKey is JBORFRFCQBWOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O2S/c29-16-19-10-11-22-21(14-19)24(30-17-18-6-2-1-3-7-18)27-25(26-22)28-12-13-31-23-9-5-4-8-20(23)15-28/h1-11,14,16H,12-13,15,17H2.
What are the key properties of 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde?
2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde has a molecular weight of 427.53 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-phenylmethoxyquinazoline-6-carbaldehyde is sourced from PubChem (CID 86691435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).