C19H25ClN4OS2 — CID 8669153
N-(2-chloro-4,6-dimethylphenyl)-N-[4-[(2-methylpropylcarbamothioylamino)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 8669153) has the molecular formula C19H25ClN4OS2 and a molecular weight of 425.02 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N-[4-[(2-methylpropylcarbamothioylamino)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N-[4-[(2-methylpropylcarbamothioylamino)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8669153 |
| Molecular Formula | C19H25ClN4OS2 |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N-[4-[(2-methylpropylcarbamothioylamino)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nc(CNC(=S)NCC(C)C)cs1)c1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C19H25ClN4OS2/c1-11(2)8-21-18(26)22-9-15-10-27-19(23-15)24(14(5)25)17-13(4)6-12(3)7-16(17)20/h6-7,10-11H,8-9H2,1-5H3,(H2,21,22,26) |
| InChIKey | BXONOZCUSAYXIA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|