C20H22FN5O3S — CID 86691738
(6R)-9-fluoro-16-methylsulfonyl-13-oxa-2,16,20,21,24-pentazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaene (PubChem CID 86691738) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is (6R)-9-fluoro-16-methylsulfonyl-13-oxa-2,16,20,21,24-pentazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaene.
| Compound Name | (6R)-9-fluoro-16-methylsulfonyl-13-oxa-2,16,20,21,24-pentazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaene |
|---|---|
| PubChem CID | 86691738 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (6R)-9-fluoro-16-methylsulfonyl-13-oxa-2,16,20,21,24-pentazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaene |
| SMILES | CS(=O)(=O)N1CCOc2ccc(F)cc2[C@H]2CCCN2c2ccn3ncc(c3n2)C1 |
| InChI | InChI=1S/C20H22FN5O3S/c1-30(27,28)24-9-10-29-18-5-4-15(21)11-16(18)17-3-2-7-25(17)19-6-8-26-20(23-19)14(13-24)12-22-26/h4-6,8,11-12,17H,2-3,7,9-10,13H2,1H3/t17-/m1/s1 |
| InChIKey | RUEGWTWYCFYYGV-QGZVFWFLSA-N |
| XLogP | 2.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |