C20H24BrN3O — CID 86691860
5-[5-(bromomethyl)-2-methylphenyl]-1-(2,2-dimethylpropyl)-3-methylimidazo[4,5-b]pyridin-2-one (PubChem CID 86691860) has the molecular formula C20H24BrN3O and a molecular weight of 402.34 g/mol. Its IUPAC name is 5-[5-(bromomethyl)-2-methylphenyl]-1-(2,2-dimethylpropyl)-3-methylimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-[5-(bromomethyl)-2-methylphenyl]-1-(2,2-dimethylpropyl)-3-methylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 86691860 |
| Molecular Formula | C20H24BrN3O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-[5-(bromomethyl)-2-methylphenyl]-1-(2,2-dimethylpropyl)-3-methylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1ccc(CBr)cc1-c1ccc2c(n1)n(C)c(=O)n2CC(C)(C)C |
| InChI | InChI=1S/C20H24BrN3O/c1-13-6-7-14(11-21)10-15(13)16-8-9-17-18(22-16)23(5)19(25)24(17)12-20(2,3)4/h6-10H,11-12H2,1-5H3 |
| InChIKey | OVQHMDWRAGWWOS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|